C24H30N4O3S — CID 91233287
N-[2-tert-butyl-4-[2-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]phenyl]ethanesulfonamide (PubChem CID 91233287) has the molecular formula C24H30N4O3S and a molecular weight of 454.60 g/mol. Its IUPAC name is N-[2-tert-butyl-4-[2-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]phenyl]ethanesulfonamide.
| Compound Name | N-[2-tert-butyl-4-[2-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 91233287 |
| Molecular Formula | C24H30N4O3S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | N-[2-tert-butyl-4-[2-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]phenyl]ethanesulfonamide |
| SMILES | [H]/N=C1/c2nc(C3CC3)ccc2CN1CC(=O)c1ccc(NS(=O)(=O)CC)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H30N4O3S/c1-5-32(30,31)27-20-11-8-16(12-18(20)24(2,3)4)21(29)14-28-13-17-9-10-19(15-6-7-15)26-22(17)23(28)25/h8-12,15,25,27H,5-7,13-14H2,1-4H3/b25-23- |
| InChIKey | OQUJJIVYCLMTPT-BZZOAKBMSA-N |
| XLogP | 4.04 |
| TPSA | 103.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|