C25H31N3O4 — CID 67138305
3-[3-tert-butyl-5-[2-(2-ethyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-2-methoxyphenyl]propanoic acid (PubChem CID 67138305) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is 3-[3-tert-butyl-5-[2-(2-ethyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-2-methoxyphenyl]propanoic acid.
| Compound Name | 3-[3-tert-butyl-5-[2-(2-ethyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-2-methoxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 67138305 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 3-[3-tert-butyl-5-[2-(2-ethyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-2-methoxyphenyl]propanoic acid |
| SMILES | [H]/N=C1/c2nc(CC)ccc2CN1CC(=O)c1cc(CCC(=O)O)c(OC)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H31N3O4/c1-6-18-9-7-16-13-28(24(26)22(16)27-18)14-20(29)17-11-15(8-10-21(30)31)23(32-5)19(12-17)25(2,3)4/h7,9,11-12,26H,6,8,10,13-14H2,1-5H3,(H,30,31)/b26-24- |
| InChIKey | VIVOLKUINOZXHS-LCUIJRPUSA-N |
| XLogP | 3.99 |
| TPSA | 103.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|