C25H31FN6O4 — CID 174440874
5-[2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)acetyl]-1,3,3-tris(methylamino)indol-2-one (PubChem CID 174440874) has the molecular formula C25H31FN6O4 and a molecular weight of 498.56 g/mol. Its IUPAC name is 5-[2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)acetyl]-1,3,3-tris(methylamino)indol-2-one.
| Compound Name | 5-[2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)acetyl]-1,3,3-tris(methylamino)indol-2-one |
|---|---|
| PubChem CID | 174440874 |
| Molecular Formula | C25H31FN6O4 |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 5-[2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)acetyl]-1,3,3-tris(methylamino)indol-2-one |
| SMILES | [H]/N=C1\c2c(cc(OCC)c(OCC)c2F)CN1CC(=O)c1ccc2c(c1)C(NC)(NC)C(=O)N2NC |
| InChI | InChI=1S/C25H31FN6O4/c1-6-35-19-11-15-12-31(23(27)20(15)21(26)22(19)36-7-2)13-18(33)14-8-9-17-16(10-14)25(28-3,29-4)24(34)32(17)30-5/h8-11,27-30H,6-7,12-13H2,1-5H3/b27-23+ |
| InChIKey | LDYKIJUVPKHCEG-SLEBQGDGSA-N |
| XLogP | 1.72 |
| TPSA | 119.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|