C23H27ClFN3O4 — CID 67138097
1-[3-chloro-5-(dimethylamino)-4-methoxyphenyl]-2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)ethanone (PubChem CID 67138097) has the molecular formula C23H27ClFN3O4 and a molecular weight of 463.94 g/mol. Its IUPAC name is 1-[3-chloro-5-(dimethylamino)-4-methoxyphenyl]-2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)ethanone.
| Compound Name | 1-[3-chloro-5-(dimethylamino)-4-methoxyphenyl]-2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)ethanone |
|---|---|
| PubChem CID | 67138097 |
| Molecular Formula | C23H27ClFN3O4 |
| Molecular Weight | 463.94 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 1-[3-chloro-5-(dimethylamino)-4-methoxyphenyl]-2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)ethanone |
| SMILES | [H]/N=C1/c2c(cc(OCC)c(OCC)c2F)CN1CC(=O)c1cc(Cl)c(OC)c(N(C)C)c1 |
| InChI | InChI=1S/C23H27ClFN3O4/c1-6-31-18-10-14-11-28(23(26)19(14)20(25)22(18)32-7-2)12-17(29)13-8-15(24)21(30-5)16(9-13)27(3)4/h8-10,26H,6-7,11-12H2,1-5H3/b26-23- |
| InChIKey | DYGUIFAFDTZBST-RWEWTDSWSA-N |
| XLogP | 4.37 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.94 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|