C26H34FN3O4 — CID 69173712
1-[3-butyl-4-methoxy-5-(methylamino)phenyl]-2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)ethanone (PubChem CID 69173712) has the molecular formula C26H34FN3O4 and a molecular weight of 471.57 g/mol. Its IUPAC name is 1-[3-butyl-4-methoxy-5-(methylamino)phenyl]-2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)ethanone.
| Compound Name | 1-[3-butyl-4-methoxy-5-(methylamino)phenyl]-2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)ethanone |
|---|---|
| PubChem CID | 69173712 |
| Molecular Formula | C26H34FN3O4 |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | 1-[3-butyl-4-methoxy-5-(methylamino)phenyl]-2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)ethanone |
| SMILES | [H]/N=C1/c2c(cc(OCC)c(OCC)c2F)CN1CC(=O)c1cc(CCCC)c(OC)c(NC)c1 |
| InChI | InChI=1S/C26H34FN3O4/c1-6-9-10-16-11-17(12-19(29-4)24(16)32-5)20(31)15-30-14-18-13-21(33-7-2)25(34-8-3)23(27)22(18)26(30)28/h11-13,28-29H,6-10,14-15H2,1-5H3/b28-26- |
| InChIKey | KRYAMFYVDQWGEC-SGEDCAFJSA-N |
| XLogP | 5.04 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|