C22H23F6N3O4S — CID 58137416
N-[3-[2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)acetyl]-5-(pentafluoro-λ6-sulfanyl)phenyl]acetamide (PubChem CID 58137416) has the molecular formula C22H23F6N3O4S and a molecular weight of 539.50 g/mol. Its IUPAC name is N-[3-[2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)acetyl]-5-(pentafluoro-λ6-sulfanyl)phenyl]acetamide.
| Compound Name | N-[3-[2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)acetyl]-5-(pentafluoro-λ6-sulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 58137416 |
| Molecular Formula | C22H23F6N3O4S |
| Molecular Weight | 539.50 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | N-[3-[2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)acetyl]-5-(pentafluoro-λ6-sulfanyl)phenyl]acetamide |
| SMILES | [H]/N=C1/c2c(cc(OCC)c(OCC)c2F)CN1CC(=O)c1cc(NC(C)=O)cc(S(F)(F)(F)(F)F)c1 |
| InChI | InChI=1S/C22H23F6N3O4S/c1-4-34-18-8-14-10-31(22(29)19(14)20(23)21(18)35-5-2)11-17(33)13-6-15(30-12(3)32)9-16(7-13)36(24,25,26,27)28/h6-9,29H,4-5,10-11H2,1-3H3,(H,30,32)/b29-22- |
| InChIKey | VDUYAAGQPGBYJK-IADYIPOJSA-N |
| XLogP | 6.26 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.50 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|