C20H20BF6N3O3S — CID 148723931
CID 148723931 (PubChem CID 148723931) has the molecular formula C20H20BF6N3O3S and a molecular weight of 507.27 g/mol.
| Compound Name | CID 148723931 |
|---|---|
| PubChem CID | 148723931 |
| Molecular Formula | C20H20BF6N3O3S |
| Molecular Weight | 507.27 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | — |
| SMILES | [H]/N=C1/c2c(cc(OCC)c(OCC)c2F)CN1CC(=O)c1cc([B])c(S(F)(F)(F)(F)F)cc1N |
| InChI | InChI=1S/C20H20BF6N3O3S/c1-3-32-15-5-10-8-30(20(29)17(10)18(22)19(15)33-4-2)9-14(31)11-6-12(21)16(7-13(11)28)34(23,24,25,26)27/h5-7,29H,3-4,8-9,28H2,1-2H3/b29-20- |
| InChIKey | MMRGDDMVCJCJAY-BRPDVVIDSA-N |
| XLogP | 4.68 |
| TPSA | 88.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.27 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|