C7H11N3O2S — CID 22930683
ethyl 3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)propanoate (PubChem CID 22930683) has the molecular formula C7H11N3O2S and a molecular weight of 201.25 g/mol. Its IUPAC name is ethyl 3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)propanoate.
| Compound Name | ethyl 3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)propanoate |
|---|---|
| PubChem CID | 22930683 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | ethyl 3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)propanoate |
| SMILES | CCOC(=O)CCc1nc(=S)[nH][nH]1 |
| InChI | InChI=1S/C7H11N3O2S/c1-2-12-6(11)4-3-5-8-7(13)10-9-5/h2-4H2,1H3,(H2,8,9,10,13) |
| InChIKey | NODPVOZTCGADCG-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|