C8H14N3NaO2S — CID 173446283
sodium;ethyl 4-(5-sulfanylidene-1,2-dihydrotriazol-4-yl)butanoate;hydride (PubChem CID 173446283) has the molecular formula C8H14N3NaO2S and a molecular weight of 239.28 g/mol. Its IUPAC name is sodium;ethyl 4-(5-sulfanylidene-1,2-dihydrotriazol-4-yl)butanoate;hydride.
| Compound Name | sodium;ethyl 4-(5-sulfanylidene-1,2-dihydrotriazol-4-yl)butanoate;hydride |
|---|---|
| PubChem CID | 173446283 |
| Molecular Formula | C8H14N3NaO2S |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | sodium;ethyl 4-(5-sulfanylidene-1,2-dihydrotriazol-4-yl)butanoate;hydride |
| SMILES | CCOC(=O)CCCc1n[nH][nH]c1=S.[H-].[Na+] |
| InChI | InChI=1S/C8H13N3O2S.Na.H/c1-2-13-7(12)5-3-4-6-8(14)10-11-9-6;;/h2-5H2,1H3,(H2,9,10,11,14);;/q;+1;-1 |
| InChIKey | OEMQPRNFQVSLSD-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|