C14H17N3O — CID 22931147
7-(1-methylpiperidin-4-yl)-6H-1,6-naphthyridin-5-one (PubChem CID 22931147) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is 7-(1-methylpiperidin-4-yl)-6H-1,6-naphthyridin-5-one.
| Compound Name | 7-(1-methylpiperidin-4-yl)-6H-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 22931147 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 7-(1-methylpiperidin-4-yl)-6H-1,6-naphthyridin-5-one |
| SMILES | CN1CCC(c2cc3ncccc3c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C14H17N3O/c1-17-7-4-10(5-8-17)12-9-13-11(14(18)16-12)3-2-6-15-13/h2-3,6,9-10H,4-5,7-8H2,1H3,(H,16,18) |
| InChIKey | XJDKRGHZVMVBMZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |