C18H21N3O3 — CID 92571730
7-[(3S)-1-(oxane-4-carbonyl)pyrrolidin-3-yl]-6H-1,6-naphthyridin-5-one (PubChem CID 92571730) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 7-[(3S)-1-(oxane-4-carbonyl)pyrrolidin-3-yl]-6H-1,6-naphthyridin-5-one.
| Compound Name | 7-[(3S)-1-(oxane-4-carbonyl)pyrrolidin-3-yl]-6H-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 92571730 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 7-[(3S)-1-(oxane-4-carbonyl)pyrrolidin-3-yl]-6H-1,6-naphthyridin-5-one |
| SMILES | O=C(C1CCOCC1)N1CC[C@H](c2cc3ncccc3c(=O)[nH]2)C1 |
| InChI | InChI=1S/C18H21N3O3/c22-17-14-2-1-6-19-16(14)10-15(20-17)13-3-7-21(11-13)18(23)12-4-8-24-9-5-12/h1-2,6,10,12-13H,3-5,7-9,11H2,(H,20,22)/t13-/m0/s1 |
| InChIKey | GMAFUZJVMNUMRN-ZDUSSCGKSA-N |
| XLogP | 1.67 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |