C22H23N3O3 — CID 92611469
7-[1-[4-(methoxymethyl)benzoyl]piperidin-4-yl]-6H-1,6-naphthyridin-5-one (PubChem CID 92611469) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 7-[1-[4-(methoxymethyl)benzoyl]piperidin-4-yl]-6H-1,6-naphthyridin-5-one.
| Compound Name | 7-[1-[4-(methoxymethyl)benzoyl]piperidin-4-yl]-6H-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 92611469 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 7-[1-[4-(methoxymethyl)benzoyl]piperidin-4-yl]-6H-1,6-naphthyridin-5-one |
| SMILES | COCc1ccc(C(=O)N2CCC(c3cc4ncccc4c(=O)[nH]3)CC2)cc1 |
| InChI | InChI=1S/C22H23N3O3/c1-28-14-15-4-6-17(7-5-15)22(27)25-11-8-16(9-12-25)19-13-20-18(21(26)24-19)3-2-10-23-20/h2-7,10,13,16H,8-9,11-12,14H2,1H3,(H,24,26) |
| InChIKey | UKXHTKXOMALCGX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |