C16H16N2O5S — CID 22941889
[(2R)-1-(4-methoxyphenyl)sulfonyl-2,3-dihydroindol-2-yl] carbamate (PubChem CID 22941889) has the molecular formula C16H16N2O5S and a molecular weight of 348.38 g/mol. Its IUPAC name is [(2R)-1-(4-methoxyphenyl)sulfonyl-2,3-dihydroindol-2-yl] carbamate.
| Compound Name | [(2R)-1-(4-methoxyphenyl)sulfonyl-2,3-dihydroindol-2-yl] carbamate |
|---|---|
| PubChem CID | 22941889 |
| Molecular Formula | C16H16N2O5S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | [(2R)-1-(4-methoxyphenyl)sulfonyl-2,3-dihydroindol-2-yl] carbamate |
| SMILES | COc1ccc(S(=O)(=O)N2c3ccccc3C[C@H]2OC(N)=O)cc1 |
| InChI | InChI=1S/C16H16N2O5S/c1-22-12-6-8-13(9-7-12)24(20,21)18-14-5-3-2-4-11(14)10-15(18)23-16(17)19/h2-9,15H,10H2,1H3,(H2,17,19)/t15-/m1/s1 |
| InChIKey | MZDUNWKMYRVWHR-OAHLLOKOSA-N |
| XLogP | 1.87 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |