C39H34N2O3 — CID 22942847
2,4-bis[(Z)-(1-benzylquinolin-4-ylidene)methyl]-3,5-dihydroxycyclopentan-1-one (PubChem CID 22942847) has the molecular formula C39H34N2O3 and a molecular weight of 578.71 g/mol. Its IUPAC name is 2,4-bis[(Z)-(1-benzylquinolin-4-ylidene)methyl]-3,5-dihydroxycyclopentan-1-one.
| Compound Name | 2,4-bis[(Z)-(1-benzylquinolin-4-ylidene)methyl]-3,5-dihydroxycyclopentan-1-one |
|---|---|
| PubChem CID | 22942847 |
| Molecular Formula | C39H34N2O3 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | 2,4-bis[(Z)-(1-benzylquinolin-4-ylidene)methyl]-3,5-dihydroxycyclopentan-1-one |
| SMILES | O=C1C(O)C(/C=C2/C=CN(Cc3ccccc3)c3ccccc32)C(O)C1/C=C1/C=CN(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C39H34N2O3/c42-37-33(23-29-19-21-40(25-27-11-3-1-4-12-27)35-17-9-7-15-31(29)35)38(43)39(44)34(37)24-30-20-22-41(26-28-13-5-2-6-14-28)36-18-10-8-16-32(30)36/h1-24,33-34,37-38,42-43H,25-26H2/b29-23-,30-24- |
| InChIKey | BCFNROIGHWZLQN-HONQWNAWSA-N |
| XLogP | 6.76 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |