C21H24Cl2N2O3 — CID 22946156
N-[(2S)-3-(3,4-dichlorophenyl)-1-(methylamino)-1-oxopropan-2-yl]-N-hydroxy-5-phenylpentanamide (PubChem CID 22946156) has the molecular formula C21H24Cl2N2O3 and a molecular weight of 423.34 g/mol. Its IUPAC name is N-[(2S)-3-(3,4-dichlorophenyl)-1-(methylamino)-1-oxopropan-2-yl]-N-hydroxy-5-phenylpentanamide.
| Compound Name | N-[(2S)-3-(3,4-dichlorophenyl)-1-(methylamino)-1-oxopropan-2-yl]-N-hydroxy-5-phenylpentanamide |
|---|---|
| PubChem CID | 22946156 |
| Molecular Formula | C21H24Cl2N2O3 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | N-[(2S)-3-(3,4-dichlorophenyl)-1-(methylamino)-1-oxopropan-2-yl]-N-hydroxy-5-phenylpentanamide |
| SMILES | CNC(=O)[C@H](Cc1ccc(Cl)c(Cl)c1)N(O)C(=O)CCCCc1ccccc1 |
| InChI | InChI=1S/C21H24Cl2N2O3/c1-24-21(27)19(14-16-11-12-17(22)18(23)13-16)25(28)20(26)10-6-5-9-15-7-3-2-4-8-15/h2-4,7-8,11-13,19,28H,5-6,9-10,14H2,1H3,(H,24,27)/t19-/m0/s1 |
| InChIKey | JWLIMYCXPLJICZ-IBGZPJMESA-N |
| XLogP | 4.28 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|