C24H22O4 — CID 22946616
3,3-bis(4-hydroxy-2,3-dimethylphenyl)-2-benzofuran-1-one (PubChem CID 22946616) has the molecular formula C24H22O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 3,3-bis(4-hydroxy-2,3-dimethylphenyl)-2-benzofuran-1-one.
| Compound Name | 3,3-bis(4-hydroxy-2,3-dimethylphenyl)-2-benzofuran-1-one |
|---|---|
| PubChem CID | 22946616 |
| Molecular Formula | C24H22O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 3,3-bis(4-hydroxy-2,3-dimethylphenyl)-2-benzofuran-1-one |
| SMILES | Cc1c(O)ccc(C2(c3ccc(O)c(C)c3C)OC(=O)c3ccccc32)c1C |
| InChI | InChI=1S/C24H22O4/c1-13-15(3)21(25)11-9-18(13)24(19-10-12-22(26)16(4)14(19)2)20-8-6-5-7-17(20)23(27)28-24/h5-12,25-26H,1-4H3 |
| InChIKey | LQFTYPCBLBTZMZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |