C24H16Hg2O9 — CID 16683084
acetyloxy-[5'-(acetyloxymercurio)-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4'-yl]mercury (PubChem CID 16683084) has the molecular formula C24H16Hg2O9 and a molecular weight of 849.56 g/mol. Its IUPAC name is acetyloxy-[5'-(acetyloxymercurio)-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4'-yl]mercury.
| Compound Name | acetyloxy-[5'-(acetyloxymercurio)-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4'-yl]mercury |
|---|---|
| PubChem CID | 16683084 |
| Molecular Formula | C24H16Hg2O9 |
| Molecular Weight | 849.56 g/mol |
| Exact Mass | 852.02 |
| IUPAC Name | acetyloxy-[5'-(acetyloxymercurio)-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4'-yl]mercury |
| SMILES | CC(=O)O[Hg]c1c(O)ccc2c1Oc1c(ccc(O)c1[Hg]OC(C)=O)C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C20H10O5.2C2H4O2.2Hg/c21-11-5-7-15-17(9-11)24-18-10-12(22)6-8-16(18)20(15)14-4-2-1-3-13(14)19(23)25-20;2*1-2(3)4;;/h1-8,21-22H;2*1H3,(H,3,4);;/q;;;2*+1/p-2 |
| InChIKey | QSZMOZPZBXFCDN-UHFFFAOYSA-L |
| XLogP | 2.04 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.56 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|