C21H15N3O6 — CID 162511997
[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4'-yl)amino]urea (PubChem CID 162511997) has the molecular formula C21H15N3O6 and a molecular weight of 405.37 g/mol. Its IUPAC name is [(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4'-yl)amino]urea.
| Compound Name | [(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4'-yl)amino]urea |
|---|---|
| PubChem CID | 162511997 |
| Molecular Formula | C21H15N3O6 |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | [(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4'-yl)amino]urea |
| SMILES | NC(=O)NNc1c(O)ccc2c1Oc1cc(O)ccc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C21H15N3O6/c22-20(28)24-23-17-15(26)8-7-14-18(17)29-16-9-10(25)5-6-13(16)21(14)12-4-2-1-3-11(12)19(27)30-21/h1-9,23,25-26H,(H3,22,24,28) |
| InChIKey | BIRABKXVVIDAHN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|