C13H11N3O2 — CID 22947508
phenyl 2,3-dihydro-1H-benzotriazole-5-carboxylate (PubChem CID 22947508) has the molecular formula C13H11N3O2 and a molecular weight of 241.25 g/mol. Its IUPAC name is phenyl 2,3-dihydro-1H-benzotriazole-5-carboxylate.
| Compound Name | phenyl 2,3-dihydro-1H-benzotriazole-5-carboxylate |
|---|---|
| PubChem CID | 22947508 |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | phenyl 2,3-dihydro-1H-benzotriazole-5-carboxylate |
| SMILES | O=C(Oc1ccccc1)c1ccc2c(c1)NNN2 |
| InChI | InChI=1S/C13H11N3O2/c17-13(18-10-4-2-1-3-5-10)9-6-7-11-12(8-9)15-16-14-11/h1-8,14-16H |
| InChIKey | WEQJMCGFHYPLGB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|