C20H4Br4Cl2K2O5 — CID 22948
dipotassium;2',4',5',7'-tetrabromo-4,7-dichloro-3-oxospiro[2-benzofuran-1,9'-xanthene]-3',6'-diolate (PubChem CID 22948) has the molecular formula C20H4Br4Cl2K2O5 and a molecular weight of 792.96 g/mol. Its IUPAC name is dipotassium;2',4',5',7'-tetrabromo-4,7-dichloro-3-oxospiro[2-benzofuran-1,9'-xanthene]-3',6'-diolate.
| Compound Name | dipotassium;2',4',5',7'-tetrabromo-4,7-dichloro-3-oxospiro[2-benzofuran-1,9'-xanthene]-3',6'-diolate |
|---|---|
| PubChem CID | 22948 |
| Molecular Formula | C20H4Br4Cl2K2O5 |
| Molecular Weight | 792.96 g/mol |
| Exact Mass | 787.54 |
| IUPAC Name | dipotassium;2',4',5',7'-tetrabromo-4,7-dichloro-3-oxospiro[2-benzofuran-1,9'-xanthene]-3',6'-diolate |
| SMILES | O=C1OC2(c3cc(Br)c([O-])c(Br)c3Oc3c2cc(Br)c([O-])c3Br)c2c(Cl)ccc(Cl)c21.[K+].[K+] |
| InChI | InChI=1S/C20H6Br4Cl2O5.2K/c21-7-3-5-17(13(23)15(7)27)30-18-6(4-8(22)16(28)14(18)24)20(5)12-10(26)2-1-9(25)11(12)19(29)31-20;;/h1-4,27-28H;;/q;2*+1/p-2 |
| InChIKey | JBBPTUVOZCXCSU-UHFFFAOYSA-L |
| XLogP | 0.77 |
| TPSA | 81.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.96 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |