C22H20F4N4 — CID 22948755
4-(2-fluoro-4-pyridinyl)-6-(1-methylpiperidin-4-yl)-3-[3-(trifluoromethyl)phenyl]pyridazine (PubChem CID 22948755) has the molecular formula C22H20F4N4 and a molecular weight of 416.42 g/mol. Its IUPAC name is 4-(2-fluoro-4-pyridinyl)-6-(1-methylpiperidin-4-yl)-3-[3-(trifluoromethyl)phenyl]pyridazine.
| Compound Name | 4-(2-fluoro-4-pyridinyl)-6-(1-methylpiperidin-4-yl)-3-[3-(trifluoromethyl)phenyl]pyridazine |
|---|---|
| PubChem CID | 22948755 |
| Molecular Formula | C22H20F4N4 |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 4-(2-fluoro-4-pyridinyl)-6-(1-methylpiperidin-4-yl)-3-[3-(trifluoromethyl)phenyl]pyridazine |
| SMILES | CN1CCC(c2cc(-c3ccnc(F)c3)c(-c3cccc(C(F)(F)F)c3)nn2)CC1 |
| InChI | InChI=1S/C22H20F4N4/c1-30-9-6-14(7-10-30)19-13-18(15-5-8-27-20(23)12-15)21(29-28-19)16-3-2-4-17(11-16)22(24,25)26/h2-5,8,11-14H,6-7,9-10H2,1H3 |
| InChIKey | COQWQAADUXDRJD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|