C21H24F3N3 — CID 95818569
2-[(3S)-1-cyclopentylpiperidin-3-yl]-3-[3-(trifluoromethyl)phenyl]pyrazine (PubChem CID 95818569) has the molecular formula C21H24F3N3 and a molecular weight of 375.44 g/mol. Its IUPAC name is 2-[(3S)-1-cyclopentylpiperidin-3-yl]-3-[3-(trifluoromethyl)phenyl]pyrazine.
| Compound Name | 2-[(3S)-1-cyclopentylpiperidin-3-yl]-3-[3-(trifluoromethyl)phenyl]pyrazine |
|---|---|
| PubChem CID | 95818569 |
| Molecular Formula | C21H24F3N3 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 2-[(3S)-1-cyclopentylpiperidin-3-yl]-3-[3-(trifluoromethyl)phenyl]pyrazine |
| SMILES | FC(F)(F)c1cccc(-c2nccnc2[C@H]2CCCN(C3CCCC3)C2)c1 |
| InChI | InChI=1S/C21H24F3N3/c22-21(23,24)17-7-3-5-15(13-17)19-20(26-11-10-25-19)16-6-4-12-27(14-16)18-8-1-2-9-18/h3,5,7,10-11,13,16,18H,1-2,4,6,8-9,12,14H2/t16-/m0/s1 |
| InChIKey | HZYZHIUCWCPYOW-INIZCTEOSA-N |
| XLogP | 5.28 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |