C12H18W — CID 22948931
carbanide;1,2,3,4,5-pentamethylbenzene-6-ide;tungsten(2+) (PubChem CID 22948931) has the molecular formula C12H18W and a molecular weight of 346.12 g/mol. Its IUPAC name is carbanide;1,2,3,4,5-pentamethylbenzene-6-ide;tungsten(2+).
| Compound Name | carbanide;1,2,3,4,5-pentamethylbenzene-6-ide;tungsten(2+) |
|---|---|
| PubChem CID | 22948931 |
| Molecular Formula | C12H18W |
| Molecular Weight | 346.12 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | carbanide;1,2,3,4,5-pentamethylbenzene-6-ide;tungsten(2+) |
| SMILES | Cc1[c-]c(C)c(C)c(C)c1C.[CH3-].[W+2] |
| InChI | InChI=1S/C11H15.CH3.W/c1-7-6-8(2)10(4)11(5)9(7)3;;/h1-5H3;1H3;/q2*-1;+2 |
| InChIKey | DPTIHGFRDSFQIX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.12 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|