C10H12Y14-2 — CID 21335492
1,2,3,5-tetramethylbenzene-4,6-diide;tetradecakis(yttrium) (PubChem CID 21335492) has the molecular formula C10H12Y14-2 and a molecular weight of 1376.89 g/mol. Its IUPAC name is 1,2,3,5-tetramethylbenzene-4,6-diide;tetradecakis(yttrium).
| Compound Name | 1,2,3,5-tetramethylbenzene-4,6-diide;tetradecakis(yttrium) |
|---|---|
| PubChem CID | 21335492 |
| Molecular Formula | C10H12Y14-2 |
| Molecular Weight | 1376.89 g/mol |
| Exact Mass | 1376.78 |
| IUPAC Name | 1,2,3,5-tetramethylbenzene-4,6-diide;tetradecakis(yttrium) |
| SMILES | Cc1[c-]c(C)c(C)c(C)[c-]1.[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y] |
| InChI | InChI=1S/C10H12.14Y/c1-7-5-8(2)10(4)9(3)6-7;;;;;;;;;;;;;;/h1-4H3;;;;;;;;;;;;;;/q-2;;;;;;;;;;;;;; |
| InChIKey | XTIOIMFGUYQPMM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1376.89 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|