C9H14N3O5S2- — CID 22950351
CID 22950351 (PubChem CID 22950351) has the molecular formula C9H14N3O5S2- and a molecular weight of 308.36 g/mol.
| Compound Name | CID 22950351 |
|---|---|
| PubChem CID | 22950351 |
| Molecular Formula | C9H14N3O5S2- |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | — |
| SMILES | [H]/N=[S-](=O)/C(C)C(=O)NCC(=O)N1CSCC1C(=O)O |
| InChI | InChI=1S/C9H14N3O5S2/c1-5(19(10)17)8(14)11-2-7(13)12-4-18-3-6(12)9(15)16/h5-6,10H,2-4H2,1H3,(H,11,14)(H,15,16)/q-1 |
| InChIKey | OLIZKXGMYGYHMD-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 127.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|