C17H22Cl2N4 — CID 22951024
6-(2,4-dichlorophenyl)-4-N-heptan-3-ylpyrimidine-4,5-diamine (PubChem CID 22951024) has the molecular formula C17H22Cl2N4 and a molecular weight of 353.30 g/mol. Its IUPAC name is 6-(2,4-dichlorophenyl)-4-N-heptan-3-ylpyrimidine-4,5-diamine.
| Compound Name | 6-(2,4-dichlorophenyl)-4-N-heptan-3-ylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 22951024 |
| Molecular Formula | C17H22Cl2N4 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 6-(2,4-dichlorophenyl)-4-N-heptan-3-ylpyrimidine-4,5-diamine |
| SMILES | CCCCC(CC)Nc1ncnc(-c2ccc(Cl)cc2Cl)c1N |
| InChI | InChI=1S/C17H22Cl2N4/c1-3-5-6-12(4-2)23-17-15(20)16(21-10-22-17)13-8-7-11(18)9-14(13)19/h7-10,12H,3-6,20H2,1-2H3,(H,21,22,23) |
| InChIKey | XTCUIGDVAOWJFJ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |