C35H33N3O5S — CID 22951547
3-[[(2S)-2-cyano-2-[[(2S)-2-[(2,2-diphenylacetyl)amino]-3-(3-methylphenyl)propanoyl]amino]ethoxy]methylsulfanyl]benzoic acid (PubChem CID 22951547) has the molecular formula C35H33N3O5S and a molecular weight of 607.73 g/mol. Its IUPAC name is 3-[[(2S)-2-cyano-2-[[(2S)-2-[(2,2-diphenylacetyl)amino]-3-(3-methylphenyl)propanoyl]amino]ethoxy]methylsulfanyl]benzoic acid.
| Compound Name | 3-[[(2S)-2-cyano-2-[[(2S)-2-[(2,2-diphenylacetyl)amino]-3-(3-methylphenyl)propanoyl]amino]ethoxy]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 22951547 |
| Molecular Formula | C35H33N3O5S |
| Molecular Weight | 607.73 g/mol |
| Exact Mass | 607.21 |
| IUPAC Name | 3-[[(2S)-2-cyano-2-[[(2S)-2-[(2,2-diphenylacetyl)amino]-3-(3-methylphenyl)propanoyl]amino]ethoxy]methylsulfanyl]benzoic acid |
| SMILES | Cc1cccc(C[C@H](NC(=O)C(c2ccccc2)c2ccccc2)C(=O)N[C@@H](C#N)COCSc2cccc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C35H33N3O5S/c1-24-10-8-11-25(18-24)19-31(38-34(40)32(26-12-4-2-5-13-26)27-14-6-3-7-15-27)33(39)37-29(21-36)22-43-23-44-30-17-9-16-28(20-30)35(41)42/h2-18,20,29,31-32H,19,22-23H2,1H3,(H,37,39)(H,38,40)(H,41,42)/t29-,31-/m0/s1 |
| InChIKey | GPENEXKUCMVZNV-SMCANUKXSA-N |
| XLogP | 5.33 |
| TPSA | 128.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.73 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|