About carbanide;dichlororuthenium;pentane
carbanide;dichlororuthenium;pentane (PubChem CID 22956552) has the molecular formula C6H13Cl2Ru-3
and a molecular weight of 257.15 g/mol. Its IUPAC name is carbanide;dichlororuthenium;pentane.
Molecular Properties
| Compound Name | carbanide;dichlororuthenium;pentane |
| PubChem CID | 22956552 |
| Molecular Formula | C6H13Cl2Ru-3 |
| Molecular Weight | 257.15 g/mol |
| Exact Mass | 256.95 |
| IUPAC Name | carbanide;dichlororuthenium;pentane |
| SMILES | C[CH-]C[CH-]C.Cl[Ru]Cl.[CH3-] |
| InChI | InChI=1S/C5H10.CH3.2ClH.Ru/c1-3-5-4-2;;;;/h3-4H,5H2,1-2H3;1H3;2*1H;/q-2;-1;;;+2/p-2 |
| InChIKey | JQSUUGDQBGYPCY-UHFFFAOYSA-L |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.15 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;dichlororuthenium;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;dichlororuthenium;pentane?
The IUPAC name of carbanide;dichlororuthenium;pentane (CID 22956552) is carbanide;dichlororuthenium;pentane.
What is the SMILES notation for carbanide;dichlororuthenium;pentane?
The canonical SMILES for carbanide;dichlororuthenium;pentane is C[CH-]C[CH-]C.Cl[Ru]Cl.[CH3-].
What is the InChIKey of carbanide;dichlororuthenium;pentane?
The InChIKey is JQSUUGDQBGYPCY-UHFFFAOYSA-L. The full InChI is InChI=1S/C5H10.CH3.2ClH.Ru/c1-3-5-4-2;;;;/h3-4H,5H2,1-2H3;1H3;2*1H;/q-2;-1;;;+2/p-2.
What are the key properties of carbanide;dichlororuthenium;pentane?
carbanide;dichlororuthenium;pentane has a molecular weight of 257.15 g/mol, XLogP of 3.65, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;dichlororuthenium;pentane is sourced from PubChem (CID 22956552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).