C22H23AcCl2N3O2 — CID 22957243
actinium;3,4-dichloro-N-[2-hydroxy-7-(pyrrolidin-1-ylmethylideneamino)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide (PubChem CID 22957243) has the molecular formula C22H23AcCl2N3O2 and a molecular weight of 659.35 g/mol. Its IUPAC name is actinium;3,4-dichloro-N-[2-hydroxy-7-(pyrrolidin-1-ylmethylideneamino)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide.
| Compound Name | actinium;3,4-dichloro-N-[2-hydroxy-7-(pyrrolidin-1-ylmethylideneamino)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide |
|---|---|
| PubChem CID | 22957243 |
| Molecular Formula | C22H23AcCl2N3O2 |
| Molecular Weight | 659.35 g/mol |
| Exact Mass | 658.14 |
| IUPAC Name | actinium;3,4-dichloro-N-[2-hydroxy-7-(pyrrolidin-1-ylmethylideneamino)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide |
| SMILES | O=C(NC1c2cc(/N=C/N3CCCC3)ccc2CCC1O)c1ccc(Cl)c(Cl)c1.[Ac] |
| InChI | InChI=1S/C22H23Cl2N3O2.Ac/c23-18-7-4-15(11-19(18)24)22(29)26-21-17-12-16(25-13-27-9-1-2-10-27)6-3-14(17)5-8-20(21)28;/h3-4,6-7,11-13,20-21,28H,1-2,5,8-10H2,(H,26,29);/b25-13+; |
| InChIKey | LJZLCIFUAKFUJW-FEIRLWDVSA-N |
| XLogP | 4.53 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.35 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|