C25H31F4N5O — CID 22957266
2-[4-(N,N'-dimethylcarbamimidoyl)piperazin-1-yl]-N-[2-[3-fluoro-5-(trifluoromethyl)phenyl]ethyl]-N-methyl-2-phenylacetamide (PubChem CID 22957266) has the molecular formula C25H31F4N5O and a molecular weight of 493.55 g/mol. Its IUPAC name is 2-[4-(N,N'-dimethylcarbamimidoyl)piperazin-1-yl]-N-[2-[3-fluoro-5-(trifluoromethyl)phenyl]ethyl]-N-methyl-2-phenylacetamide.
| Compound Name | 2-[4-(N,N'-dimethylcarbamimidoyl)piperazin-1-yl]-N-[2-[3-fluoro-5-(trifluoromethyl)phenyl]ethyl]-N-methyl-2-phenylacetamide |
|---|---|
| PubChem CID | 22957266 |
| Molecular Formula | C25H31F4N5O |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | 2-[4-(N,N'-dimethylcarbamimidoyl)piperazin-1-yl]-N-[2-[3-fluoro-5-(trifluoromethyl)phenyl]ethyl]-N-methyl-2-phenylacetamide |
| SMILES | C/N=C(\NC)N1CCN(C(C(=O)N(C)CCc2cc(F)cc(C(F)(F)F)c2)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H31F4N5O/c1-30-24(31-2)34-13-11-33(12-14-34)22(19-7-5-4-6-8-19)23(35)32(3)10-9-18-15-20(25(27,28)29)17-21(26)16-18/h4-8,15-17,22H,9-14H2,1-3H3,(H,30,31) |
| InChIKey | CMWVKRJBWAFMCG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|