C18H31NO3 — CID 22961472
methyl 8-[methyl-[(2E,4E)-6-methylhepta-2,4-dienyl]amino]-8-oxooctanoate (PubChem CID 22961472) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is methyl 8-[methyl-[(2E,4E)-6-methylhepta-2,4-dienyl]amino]-8-oxooctanoate.
| Compound Name | methyl 8-[methyl-[(2E,4E)-6-methylhepta-2,4-dienyl]amino]-8-oxooctanoate |
|---|---|
| PubChem CID | 22961472 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | methyl 8-[methyl-[(2E,4E)-6-methylhepta-2,4-dienyl]amino]-8-oxooctanoate |
| SMILES | COC(=O)CCCCCCC(=O)N(C)C/C=C/C=C/C(C)C |
| InChI | InChI=1S/C18H31NO3/c1-16(2)12-8-7-11-15-19(3)17(20)13-9-5-6-10-14-18(21)22-4/h7-8,11-12,16H,5-6,9-10,13-15H2,1-4H3/b11-7+,12-8+ |
| InChIKey | MIBZFCHDLCEFGO-MKICQXMISA-N |
| XLogP | 3.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|