C9H12BN5O3 — CID 22961718
CID 22961718 (PubChem CID 22961718) has the molecular formula C9H12BN5O3 and a molecular weight of 249.04 g/mol.
| Compound Name | CID 22961718 |
|---|---|
| PubChem CID | 22961718 |
| Molecular Formula | C9H12BN5O3 |
| Molecular Weight | 249.04 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | — |
| SMILES | [B]C(=O)n1cnc(CC(N)C(=O)NCC(N)=O)c1 |
| InChI | InChI=1S/C9H12BN5O3/c10-9(18)15-3-5(14-4-15)1-6(11)8(17)13-2-7(12)16/h3-4,6H,1-2,11H2,(H2,12,16)(H,13,17) |
| InChIKey | OSKLCPHGGTXDGZ-UHFFFAOYSA-N |
| XLogP | -2.51 |
| TPSA | 133.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.04 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|