C16H22FNO5S — CID 22963114
(1Z)-2-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methylsulfonyl]-N-methoxyethanimidoyl fluoride (PubChem CID 22963114) has the molecular formula C16H22FNO5S and a molecular weight of 359.42 g/mol. Its IUPAC name is (1Z)-2-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methylsulfonyl]-N-methoxyethanimidoyl fluoride.
| Compound Name | (1Z)-2-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methylsulfonyl]-N-methoxyethanimidoyl fluoride |
|---|---|
| PubChem CID | 22963114 |
| Molecular Formula | C16H22FNO5S |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | (1Z)-2-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methylsulfonyl]-N-methoxyethanimidoyl fluoride |
| SMILES | C/C=C/COc1cc(C)c(OCS(=O)(=O)C/C(F)=N/OC)c(C)c1 |
| InChI | InChI=1S/C16H22FNO5S/c1-5-6-7-22-14-8-12(2)16(13(3)9-14)23-11-24(19,20)10-15(17)18-21-4/h5-6,8-9H,7,10-11H2,1-4H3/b6-5+,18-15- |
| InChIKey | OTFPXYDCJZHGAW-GCCLZIPMSA-N |
| XLogP | 2.94 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|