C21H32FNO3S — CID 23379572
(1Z)-2-[6-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]hexylsulfanyl]-N-methoxyethanimidoyl fluoride (PubChem CID 23379572) has the molecular formula C21H32FNO3S and a molecular weight of 397.56 g/mol. Its IUPAC name is (1Z)-2-[6-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]hexylsulfanyl]-N-methoxyethanimidoyl fluoride.
| Compound Name | (1Z)-2-[6-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]hexylsulfanyl]-N-methoxyethanimidoyl fluoride |
|---|---|
| PubChem CID | 23379572 |
| Molecular Formula | C21H32FNO3S |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | (1Z)-2-[6-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]hexylsulfanyl]-N-methoxyethanimidoyl fluoride |
| SMILES | C/C=C/COc1cc(C)c(OCCCCCCSC/C(F)=N/OC)c(C)c1 |
| InChI | InChI=1S/C21H32FNO3S/c1-5-6-11-25-19-14-17(2)21(18(3)15-19)26-12-9-7-8-10-13-27-16-20(22)23-24-4/h5-6,14-15H,7-13,16H2,1-4H3/b6-5+,23-20- |
| InChIKey | ZFJZAIOYOFJXQN-IXDNFEQWSA-N |
| XLogP | 5.86 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|