C20H15N3O3 — CID 22964457
[8-(benzotriazol-2-yl)-7-hydroxynaphthalen-2-yl] 2-methylprop-2-enoate (PubChem CID 22964457) has the molecular formula C20H15N3O3 and a molecular weight of 345.36 g/mol. Its IUPAC name is [8-(benzotriazol-2-yl)-7-hydroxynaphthalen-2-yl] 2-methylprop-2-enoate.
| Compound Name | [8-(benzotriazol-2-yl)-7-hydroxynaphthalen-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 22964457 |
| Molecular Formula | C20H15N3O3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | [8-(benzotriazol-2-yl)-7-hydroxynaphthalen-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc2ccc(O)c(-n3nc4ccccc4n3)c2c1 |
| InChI | InChI=1S/C20H15N3O3/c1-12(2)20(25)26-14-9-7-13-8-10-18(24)19(15(13)11-14)23-21-16-5-3-4-6-17(16)22-23/h3-11,24H,1H2,2H3 |
| InChIKey | BCEYMFJIBDJGOB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|