C18H23NO4 — CID 22967333
(2,4-dimethylbenzoyl) (1R,2R,3S,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 22967333) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is (2,4-dimethylbenzoyl) (1R,2R,3S,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | (2,4-dimethylbenzoyl) (1R,2R,3S,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 22967333 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (2,4-dimethylbenzoyl) (1R,2R,3S,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | Cc1ccc(C(=O)OC(=O)[C@@H]2[C@H]3CC[C@@H](C[C@@H]2O)N3C)c(C)c1 |
| InChI | InChI=1S/C18H23NO4/c1-10-4-6-13(11(2)8-10)17(21)23-18(22)16-14-7-5-12(19(14)3)9-15(16)20/h4,6,8,12,14-16,20H,5,7,9H2,1-3H3/t12-,14+,15-,16+/m0/s1 |
| InChIKey | KRTMJVVLDQMWGX-DRPJVOAASA-N |
| XLogP | 1.83 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|