C27H33FN4O2 — CID 22972822
3-[(7R,9aS)-7-[[3-(pyrrolidin-1-ylmethyl)phenoxy]methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-4-fluoro-1,2-benzoxazole (PubChem CID 22972822) has the molecular formula C27H33FN4O2 and a molecular weight of 464.59 g/mol. Its IUPAC name is 3-[(7R,9aS)-7-[[3-(pyrrolidin-1-ylmethyl)phenoxy]methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-4-fluoro-1,2-benzoxazole.
| Compound Name | 3-[(7R,9aS)-7-[[3-(pyrrolidin-1-ylmethyl)phenoxy]methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-4-fluoro-1,2-benzoxazole |
|---|---|
| PubChem CID | 22972822 |
| Molecular Formula | C27H33FN4O2 |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | 3-[(7R,9aS)-7-[[3-(pyrrolidin-1-ylmethyl)phenoxy]methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-4-fluoro-1,2-benzoxazole |
| SMILES | Fc1cccc2onc(N3CCN4C[C@H](COc5cccc(CN6CCCC6)c5)CC[C@H]4C3)c12 |
| InChI | InChI=1S/C27H33FN4O2/c28-24-7-4-8-25-26(24)27(29-34-25)32-14-13-31-17-21(9-10-22(31)18-32)19-33-23-6-3-5-20(15-23)16-30-11-1-2-12-30/h3-8,15,21-22H,1-2,9-14,16-19H2/t21-,22+/m1/s1 |
| InChIKey | HBXUZVVOODKUNH-YADHBBJMSA-N |
| XLogP | 4.54 |
| TPSA | 44.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |