C11H22N2 — CID 22975671
3,9-dimethyl-2,9-diazaspiro[5.5]undecane (PubChem CID 22975671) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 3,9-dimethyl-2,9-diazaspiro[5.5]undecane.
| Compound Name | 3,9-dimethyl-2,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 22975671 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 3,9-dimethyl-2,9-diazaspiro[5.5]undecane |
| SMILES | CC1CCC2(CCN(C)CC2)CN1 |
| InChI | InChI=1S/C11H22N2/c1-10-3-4-11(9-12-10)5-7-13(2)8-6-11/h10,12H,3-9H2,1-2H3 |
| InChIKey | IQSUJIFFPBPOIO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |