C12H21N3O2 — CID 22975783
tert-butyl 1,3,8-triazaspiro[4.5]dec-2-ene-8-carboxylate (PubChem CID 22975783) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is tert-butyl 1,3,8-triazaspiro[4.5]dec-2-ene-8-carboxylate.
| Compound Name | tert-butyl 1,3,8-triazaspiro[4.5]dec-2-ene-8-carboxylate |
|---|---|
| PubChem CID | 22975783 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | tert-butyl 1,3,8-triazaspiro[4.5]dec-2-ene-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CN=CN2 |
| InChI | InChI=1S/C12H21N3O2/c1-11(2,3)17-10(16)15-6-4-12(5-7-15)8-13-9-14-12/h9H,4-8H2,1-3H3,(H,13,14) |
| InChIKey | IZRXGDPOIAMAEU-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |