C39H59NO2 — CID 22976595
N-[3-[[17-[(E)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]phenyl]-2-methylbutanamide (PubChem CID 22976595) has the molecular formula C39H59NO2 and a molecular weight of 573.91 g/mol. Its IUPAC name is N-[3-[[17-[(E)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]phenyl]-2-methylbutanamide.
| Compound Name | N-[3-[[17-[(E)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]phenyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 22976595 |
| Molecular Formula | C39H59NO2 |
| Molecular Weight | 573.91 g/mol |
| Exact Mass | 573.45 |
| IUPAC Name | N-[3-[[17-[(E)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]phenyl]-2-methylbutanamide |
| SMILES | CCC(C)C(=O)Nc1cccc(OC2CCC3(C)C(=CCC4C3CCC3(C)C(C(C)/C=C/C(C)C(C)C)CCC43)C2)c1 |
| InChI | InChI=1S/C39H59NO2/c1-9-26(4)37(41)40-30-11-10-12-31(24-30)42-32-19-21-38(7)29(23-32)15-16-33-35-18-17-34(39(35,8)22-20-36(33)38)28(6)14-13-27(5)25(2)3/h10-15,24-28,32-36H,9,16-23H2,1-8H3,(H,40,41)/b14-13+ |
| InChIKey | MIANVTJARCTARK-BUHFOSPRSA-N |
| XLogP | 10.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.91 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|