C16H22N3O4P — CID 22976955
2-(aminophosphanylideneamino)-3-[1-[(2,4-dimethoxyphenyl)methyl]-2-oxopyrrolidin-3-yl]propanal (PubChem CID 22976955) has the molecular formula C16H22N3O4P and a molecular weight of 351.34 g/mol. Its IUPAC name is 2-(aminophosphanylideneamino)-3-[1-[(2,4-dimethoxyphenyl)methyl]-2-oxopyrrolidin-3-yl]propanal.
| Compound Name | 2-(aminophosphanylideneamino)-3-[1-[(2,4-dimethoxyphenyl)methyl]-2-oxopyrrolidin-3-yl]propanal |
|---|---|
| PubChem CID | 22976955 |
| Molecular Formula | C16H22N3O4P |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2-(aminophosphanylideneamino)-3-[1-[(2,4-dimethoxyphenyl)methyl]-2-oxopyrrolidin-3-yl]propanal |
| SMILES | COc1ccc(CN2CCC(CC(C=O)/N=P/N)C2=O)c(OC)c1 |
| InChI | InChI=1S/C16H22N3O4P/c1-22-14-4-3-12(15(8-14)23-2)9-19-6-5-11(16(19)21)7-13(10-20)18-24-17/h3-4,8,10-11,13H,5-7,9H2,1-2H3,(H2,17,18) |
| InChIKey | CUQMPAQEWCGHQA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|