C9H18N3O3P — CID 22976957
3-[2-(aminophosphanylideneamino)-3,3-dimethoxypropyl]pyrrolidin-2-one (PubChem CID 22976957) has the molecular formula C9H18N3O3P and a molecular weight of 247.23 g/mol. Its IUPAC name is 3-[2-(aminophosphanylideneamino)-3,3-dimethoxypropyl]pyrrolidin-2-one.
| Compound Name | 3-[2-(aminophosphanylideneamino)-3,3-dimethoxypropyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 22976957 |
| Molecular Formula | C9H18N3O3P |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 3-[2-(aminophosphanylideneamino)-3,3-dimethoxypropyl]pyrrolidin-2-one |
| SMILES | COC(OC)C(CC1CCNC1=O)/N=P/N |
| InChI | InChI=1S/C9H18N3O3P/c1-14-9(15-2)7(12-16-10)5-6-3-4-11-8(6)13/h6-7,9H,3-5H2,1-2H3,(H2,10,12)(H,11,13) |
| InChIKey | JGHAJKZIBHXSOH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|