C20H28O5 — CID 22986698
1-(4-methoxyphenyl)-7-[(4S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]hept-3-yne-1,5-diol (PubChem CID 22986698) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-7-[(4S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]hept-3-yne-1,5-diol.
| Compound Name | 1-(4-methoxyphenyl)-7-[(4S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]hept-3-yne-1,5-diol |
|---|---|
| PubChem CID | 22986698 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 1-(4-methoxyphenyl)-7-[(4S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]hept-3-yne-1,5-diol |
| SMILES | COc1ccc(C(O)CC#CC(O)CC[C@@H]2OC(C)(C)OC2C)cc1 |
| InChI | InChI=1S/C20H28O5/c1-14-19(25-20(2,3)24-14)13-10-16(21)6-5-7-18(22)15-8-11-17(23-4)12-9-15/h8-9,11-12,14,16,18-19,21-22H,7,10,13H2,1-4H3/t14?,16?,18?,19-/m0/s1 |
| InChIKey | RJRDXYABOKKKFJ-FAQOJWHQSA-N |
| XLogP | 2.80 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|