C22H17F4N5O2 — CID 22987979
3-[[4-[7-(4-fluorophenyl)-5H-pyrrolo[2,3-b]pyrazin-6-yl]-2-pyridinyl]amino]propyl 2,2,2-trifluoroacetate (PubChem CID 22987979) has the molecular formula C22H17F4N5O2 and a molecular weight of 459.40 g/mol. Its IUPAC name is 3-[[4-[7-(4-fluorophenyl)-5H-pyrrolo[2,3-b]pyrazin-6-yl]-2-pyridinyl]amino]propyl 2,2,2-trifluoroacetate.
| Compound Name | 3-[[4-[7-(4-fluorophenyl)-5H-pyrrolo[2,3-b]pyrazin-6-yl]-2-pyridinyl]amino]propyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 22987979 |
| Molecular Formula | C22H17F4N5O2 |
| Molecular Weight | 459.40 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 3-[[4-[7-(4-fluorophenyl)-5H-pyrrolo[2,3-b]pyrazin-6-yl]-2-pyridinyl]amino]propyl 2,2,2-trifluoroacetate |
| SMILES | O=C(OCCCNc1cc(-c2[nH]c3nccnc3c2-c2ccc(F)cc2)ccn1)C(F)(F)F |
| InChI | InChI=1S/C22H17F4N5O2/c23-15-4-2-13(3-5-15)17-18(31-20-19(17)29-9-10-30-20)14-6-8-28-16(12-14)27-7-1-11-33-21(32)22(24,25)26/h2-6,8-10,12H,1,7,11H2,(H,27,28)(H,30,31) |
| InChIKey | FWKYYUIJJBNAQD-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.40 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|