C17H15N4O2S+ — CID 22992348
1-(2-oxo-2-thiophen-2-ylethyl)-N'-pyridin-2-ylpyridin-1-ium-3-carbohydrazide (PubChem CID 22992348) has the molecular formula C17H15N4O2S+ and a molecular weight of 339.40 g/mol. Its IUPAC name is 1-(2-oxo-2-thiophen-2-ylethyl)-N'-pyridin-2-ylpyridin-1-ium-3-carbohydrazide.
| Compound Name | 1-(2-oxo-2-thiophen-2-ylethyl)-N'-pyridin-2-ylpyridin-1-ium-3-carbohydrazide |
|---|---|
| PubChem CID | 22992348 |
| Molecular Formula | C17H15N4O2S+ |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 1-(2-oxo-2-thiophen-2-ylethyl)-N'-pyridin-2-ylpyridin-1-ium-3-carbohydrazide |
| SMILES | O=C(NNc1ccccn1)c1ccc[n+](CC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C17H14N4O2S/c22-14(15-6-4-10-24-15)12-21-9-3-5-13(11-21)17(23)20-19-16-7-1-2-8-18-16/h1-11H,12H2,(H-,18,19,20,23)/p+1 |
| InChIKey | LCKCWRWDKBTXFU-UHFFFAOYSA-O |
| XLogP | 2.07 |
| TPSA | 74.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|