C15H16BrClN2O3S — CID 10273597
5-bromo-N-(2-methoxyethyl)-1-(2-oxo-2-thiophen-2-ylethyl)pyridin-1-ium-3-carboxamide chloride (PubChem CID 10273597) has the molecular formula C15H16BrClN2O3S and a molecular weight of 419.73 g/mol. Its IUPAC name is 5-bromo-N-(2-methoxyethyl)-1-(2-oxo-2-thiophen-2-ylethyl)pyridin-1-ium-3-carboxamide chloride.
| Compound Name | 5-bromo-N-(2-methoxyethyl)-1-(2-oxo-2-thiophen-2-ylethyl)pyridin-1-ium-3-carboxamide chloride |
|---|---|
| PubChem CID | 10273597 |
| Molecular Formula | C15H16BrClN2O3S |
| Molecular Weight | 419.73 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | 5-bromo-N-(2-methoxyethyl)-1-(2-oxo-2-thiophen-2-ylethyl)pyridin-1-ium-3-carboxamide chloride |
| SMILES | COCCNC(=O)c1cc(Br)c[n+](CC(=O)c2cccs2)c1.[Cl-] |
| InChI | InChI=1S/C15H15BrN2O3S.ClH/c1-21-5-4-17-15(20)11-7-12(16)9-18(8-11)10-13(19)14-3-2-6-22-14;/h2-3,6-9H,4-5,10H2,1H3;1H |
| InChIKey | FWPYHJUWZQBBST-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.73 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|