C14H23N3O6 — CID 22993673
2-[4-methyl-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-2,5-dioxoimidazolidin-1-yl]acetic acid (PubChem CID 22993673) has the molecular formula C14H23N3O6 and a molecular weight of 329.35 g/mol. Its IUPAC name is 2-[4-methyl-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-2,5-dioxoimidazolidin-1-yl]acetic acid.
| Compound Name | 2-[4-methyl-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-2,5-dioxoimidazolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 22993673 |
| Molecular Formula | C14H23N3O6 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 2-[4-methyl-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-2,5-dioxoimidazolidin-1-yl]acetic acid |
| SMILES | CC(C)(C)OC(=O)NCCCC1(C)NC(=O)N(CC(=O)O)C1=O |
| InChI | InChI=1S/C14H23N3O6/c1-13(2,3)23-12(22)15-7-5-6-14(4)10(20)17(8-9(18)19)11(21)16-14/h5-8H2,1-4H3,(H,15,22)(H,16,21)(H,18,19) |
| InChIKey | SSSQQVFIWMITMU-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|