C19H32N2O6 — CID 134942640
tert-butyl (3R)-1-methyl-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-2,6-dioxopiperidine-3-carboxylate (PubChem CID 134942640) has the molecular formula C19H32N2O6 and a molecular weight of 384.47 g/mol. Its IUPAC name is tert-butyl (3R)-1-methyl-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-2,6-dioxopiperidine-3-carboxylate.
| Compound Name | tert-butyl (3R)-1-methyl-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-2,6-dioxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 134942640 |
| Molecular Formula | C19H32N2O6 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | tert-butyl (3R)-1-methyl-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-2,6-dioxopiperidine-3-carboxylate |
| SMILES | CN1C(=O)CC[C@@](CCCNC(=O)OC(C)(C)C)(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C19H32N2O6/c1-17(2,3)26-15(24)19(11-9-13(22)21(7)14(19)23)10-8-12-20-16(25)27-18(4,5)6/h8-12H2,1-7H3,(H,20,25)/t19-/m1/s1 |
| InChIKey | CIIAFJSUGFSFCP-LJQANCHMSA-N |
| XLogP | 2.40 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|