C17H17BrN4O3S — CID 22993936
5-(6-bromo-2-pyridinyl)-2-N-(3,4,5-trimethoxyphenyl)-1,3-thiazole-2,4-diamine (PubChem CID 22993936) has the molecular formula C17H17BrN4O3S and a molecular weight of 437.32 g/mol. Its IUPAC name is 5-(6-bromo-2-pyridinyl)-2-N-(3,4,5-trimethoxyphenyl)-1,3-thiazole-2,4-diamine.
| Compound Name | 5-(6-bromo-2-pyridinyl)-2-N-(3,4,5-trimethoxyphenyl)-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 22993936 |
| Molecular Formula | C17H17BrN4O3S |
| Molecular Weight | 437.32 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | 5-(6-bromo-2-pyridinyl)-2-N-(3,4,5-trimethoxyphenyl)-1,3-thiazole-2,4-diamine |
| SMILES | COc1cc(Nc2nc(N)c(-c3cccc(Br)n3)s2)cc(OC)c1OC |
| InChI | InChI=1S/C17H17BrN4O3S/c1-23-11-7-9(8-12(24-2)14(11)25-3)20-17-22-16(19)15(26-17)10-5-4-6-13(18)21-10/h4-8H,19H2,1-3H3,(H,20,22) |
| InChIKey | HRSFRTHRNQEVAS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.32 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|