C15H13F3O2S — CID 22996518
2-(4-thiophen-3-ylphenyl)propyl 2,2,2-trifluoroacetate (PubChem CID 22996518) has the molecular formula C15H13F3O2S and a molecular weight of 314.33 g/mol. Its IUPAC name is 2-(4-thiophen-3-ylphenyl)propyl 2,2,2-trifluoroacetate.
| Compound Name | 2-(4-thiophen-3-ylphenyl)propyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 22996518 |
| Molecular Formula | C15H13F3O2S |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 2-(4-thiophen-3-ylphenyl)propyl 2,2,2-trifluoroacetate |
| SMILES | CC(COC(=O)C(F)(F)F)c1ccc(-c2ccsc2)cc1 |
| InChI | InChI=1S/C15H13F3O2S/c1-10(8-20-14(19)15(16,17)18)11-2-4-12(5-3-11)13-6-7-21-9-13/h2-7,9-10H,8H2,1H3 |
| InChIKey | FUHMETQVKRCLGZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |